About (2,4-dichlorophenyl) 2-[[2-(trifluoromethyl)-4-pyridinyl]amino]benzoate
(2,4-dichlorophenyl) 2-[[2-(trifluoromethyl)-4-pyridinyl]amino]benzoate (PubChem CID 11546395) has the molecular formula C19H11Cl2F3N2O2
and a molecular weight of 427.21 g/mol. Its IUPAC name is (2,4-dichlorophenyl) 2-[[2-(trifluoromethyl)-4-pyridinyl]amino]benzoate.
Molecular Properties
| Compound Name | (2,4-dichlorophenyl) 2-[[2-(trifluoromethyl)-4-pyridinyl]amino]benzoate |
| PubChem CID | 11546395 |
| Molecular Formula | C19H11Cl2F3N2O2 |
| Molecular Weight | 427.21 g/mol |
| Exact Mass | 426.01 |
| IUPAC Name | (2,4-dichlorophenyl) 2-[[2-(trifluoromethyl)-4-pyridinyl]amino]benzoate |
| SMILES | O=C(Oc1ccc(Cl)cc1Cl)c1ccccc1Nc1ccnc(C(F)(F)F)c1 |
| InChI | InChI=1S/C19H11Cl2F3N2O2/c20-11-5-6-16(14(21)9-11)28-18(27)13-3-1-2-4-15(13)26-12-7-8-25-17(10-12)19(22,23)24/h1-10H,(H,25,26) |
| InChIKey | ZKSGADBLRQHPTK-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 427.21 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (2,4-dichlorophenyl) 2-[[2-(trifluoromethyl)-4-pyridinyl]amino]benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,4-dichlorophenyl) 2-[[2-(trifluoromethyl)-4-pyridinyl]amino]benzoate?
The IUPAC name of (2,4-dichlorophenyl) 2-[[2-(trifluoromethyl)-4-pyridinyl]amino]benzoate (CID 11546395) is (2,4-dichlorophenyl) 2-[[2-(trifluoromethyl)-4-pyridinyl]amino]benzoate.
What is the SMILES notation for (2,4-dichlorophenyl) 2-[[2-(trifluoromethyl)-4-pyridinyl]amino]benzoate?
The canonical SMILES for (2,4-dichlorophenyl) 2-[[2-(trifluoromethyl)-4-pyridinyl]amino]benzoate is O=C(Oc1ccc(Cl)cc1Cl)c1ccccc1Nc1ccnc(C(F)(F)F)c1.
What is the InChIKey of (2,4-dichlorophenyl) 2-[[2-(trifluoromethyl)-4-pyridinyl]amino]benzoate?
The InChIKey is ZKSGADBLRQHPTK-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H11Cl2F3N2O2/c20-11-5-6-16(14(21)9-11)28-18(27)13-3-1-2-4-15(13)26-12-7-8-25-17(10-12)19(22,23)24/h1-10H,(H,25,26).
What are the key properties of (2,4-dichlorophenyl) 2-[[2-(trifluoromethyl)-4-pyridinyl]amino]benzoate?
(2,4-dichlorophenyl) 2-[[2-(trifluoromethyl)-4-pyridinyl]amino]benzoate has a molecular weight of 427.21 g/mol, XLogP of 6.37, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2,4-dichlorophenyl) 2-[[2-(trifluoromethyl)-4-pyridinyl]amino]benzoate is sourced from PubChem (CID 11546395), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).