C15H16N4O — CID 115466013
N-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)-4,5,6,7-tetrahydro-1-benzofuran-4-amine (PubChem CID 115466013) has the molecular formula C15H16N4O and a molecular weight of 268.32 g/mol. Its IUPAC name is N-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)-4,5,6,7-tetrahydro-1-benzofuran-4-amine.
| Compound Name | N-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)-4,5,6,7-tetrahydro-1-benzofuran-4-amine |
|---|---|
| PubChem CID | 115466013 |
| Molecular Formula | C15H16N4O |
| Molecular Weight | 268.32 g/mol |
| Exact Mass | 268.13 |
| IUPAC Name | N-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)-4,5,6,7-tetrahydro-1-benzofuran-4-amine |
| SMILES | c1ccn2c(CNC3CCCc4occc43)nnc2c1 |
| InChI | InChI=1S/C15H16N4O/c1-2-8-19-14(6-1)17-18-15(19)10-16-12-4-3-5-13-11(12)7-9-20-13/h1-2,6-9,12,16H,3-5,10H2 |
| InChIKey | MQXVJDFSTVZOAR-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 55.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.32 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |