C15H22N2O — CID 115466808
4-methyl-5-(4,5,6,7-tetrahydro-1-benzofuran-4-yl)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole (PubChem CID 115466808) has the molecular formula C15H22N2O and a molecular weight of 246.35 g/mol. Its IUPAC name is 4-methyl-5-(4,5,6,7-tetrahydro-1-benzofuran-4-yl)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole.
| Compound Name | 4-methyl-5-(4,5,6,7-tetrahydro-1-benzofuran-4-yl)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole |
|---|---|
| PubChem CID | 115466808 |
| Molecular Formula | C15H22N2O |
| Molecular Weight | 246.35 g/mol |
| Exact Mass | 246.17 |
| IUPAC Name | 4-methyl-5-(4,5,6,7-tetrahydro-1-benzofuran-4-yl)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole |
| SMILES | CC1C2CNCC2CN1C1CCCc2occc21 |
| InChI | InChI=1S/C15H22N2O/c1-10-13-8-16-7-11(13)9-17(10)14-3-2-4-15-12(14)5-6-18-15/h5-6,10-11,13-14,16H,2-4,7-9H2,1H3 |
| InChIKey | NLSGOMISEINSMV-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 28.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.35 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |