C11H18O4S — CID 115467201
5-ethylsulfonyl-2-(furan-3-yl)pentan-2-ol (PubChem CID 115467201) has the molecular formula C11H18O4S and a molecular weight of 246.33 g/mol. Its IUPAC name is 5-ethylsulfonyl-2-(furan-3-yl)pentan-2-ol.
| Compound Name | 5-ethylsulfonyl-2-(furan-3-yl)pentan-2-ol |
|---|---|
| PubChem CID | 115467201 |
| Molecular Formula | C11H18O4S |
| Molecular Weight | 246.33 g/mol |
| Exact Mass | 246.09 |
| IUPAC Name | 5-ethylsulfonyl-2-(furan-3-yl)pentan-2-ol |
| SMILES | CCS(=O)(=O)CCCC(C)(O)c1ccoc1 |
| InChI | InChI=1S/C11H18O4S/c1-3-16(13,14)8-4-6-11(2,12)10-5-7-15-9-10/h5,7,9,12H,3-4,6,8H2,1-2H3 |
| InChIKey | LVVNJWDYTFPTQD-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 67.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.33 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |