About benzyl 2-(5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)sulfanylacetate
benzyl 2-(5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)sulfanylacetate (PubChem CID 1154683) has the molecular formula C17H16N2O2S2
and a molecular weight of 344.46 g/mol. Its IUPAC name is benzyl 2-(5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)sulfanylacetate.
Molecular Properties
| Compound Name | benzyl 2-(5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)sulfanylacetate |
| PubChem CID | 1154683 |
| Molecular Formula | C17H16N2O2S2 |
| Molecular Weight | 344.46 g/mol |
| Exact Mass | 344.07 |
| IUPAC Name | benzyl 2-(5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)sulfanylacetate |
| SMILES | Cc1sc2ncnc(SCC(=O)OCc3ccccc3)c2c1C |
| InChI | InChI=1S/C17H16N2O2S2/c1-11-12(2)23-17-15(11)16(18-10-19-17)22-9-14(20)21-8-13-6-4-3-5-7-13/h3-7,10H,8-9H2,1-2H3 |
| InChIKey | LHEFRBTXQWOOCD-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 344.46 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze benzyl 2-(5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)sulfanylacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl 2-(5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)sulfanylacetate?
The IUPAC name of benzyl 2-(5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)sulfanylacetate (CID 1154683) is benzyl 2-(5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)sulfanylacetate.
What is the SMILES notation for benzyl 2-(5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)sulfanylacetate?
The canonical SMILES for benzyl 2-(5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)sulfanylacetate is Cc1sc2ncnc(SCC(=O)OCc3ccccc3)c2c1C.
What is the InChIKey of benzyl 2-(5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)sulfanylacetate?
The InChIKey is LHEFRBTXQWOOCD-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H16N2O2S2/c1-11-12(2)23-17-15(11)16(18-10-19-17)22-9-14(20)21-8-13-6-4-3-5-7-13/h3-7,10H,8-9H2,1-2H3.
What are the key properties of benzyl 2-(5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)sulfanylacetate?
benzyl 2-(5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)sulfanylacetate has a molecular weight of 344.46 g/mol, XLogP of 4.14, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl 2-(5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)sulfanylacetate is sourced from PubChem (CID 1154683), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).