C13H12F3N3O — CID 115468319
[4-(6-methylpyrimidin-4-yl)oxy-3-(trifluoromethyl)phenyl]methanamine (PubChem CID 115468319) has the molecular formula C13H12F3N3O and a molecular weight of 283.25 g/mol. Its IUPAC name is [4-(6-methylpyrimidin-4-yl)oxy-3-(trifluoromethyl)phenyl]methanamine.
| Compound Name | [4-(6-methylpyrimidin-4-yl)oxy-3-(trifluoromethyl)phenyl]methanamine |
|---|---|
| PubChem CID | 115468319 |
| Molecular Formula | C13H12F3N3O |
| Molecular Weight | 283.25 g/mol |
| Exact Mass | 283.09 |
| IUPAC Name | [4-(6-methylpyrimidin-4-yl)oxy-3-(trifluoromethyl)phenyl]methanamine |
| SMILES | Cc1cc(Oc2ccc(CN)cc2C(F)(F)F)ncn1 |
| InChI | InChI=1S/C13H12F3N3O/c1-8-4-12(19-7-18-8)20-11-3-2-9(6-17)5-10(11)13(14,15)16/h2-5,7H,6,17H2,1H3 |
| InChIKey | AADIBTPMCLEUOG-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 61.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.25 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |