C15H16ClFN2 — CID 115468939
4-chloro-2-N-[1-(2-fluorophenyl)ethyl]-2-N-methylbenzene-1,2-diamine (PubChem CID 115468939) has the molecular formula C15H16ClFN2 and a molecular weight of 278.76 g/mol. Its IUPAC name is 4-chloro-2-N-[1-(2-fluorophenyl)ethyl]-2-N-methylbenzene-1,2-diamine.
| Compound Name | 4-chloro-2-N-[1-(2-fluorophenyl)ethyl]-2-N-methylbenzene-1,2-diamine |
|---|---|
| PubChem CID | 115468939 |
| Molecular Formula | C15H16ClFN2 |
| Molecular Weight | 278.76 g/mol |
| Exact Mass | 278.10 |
| IUPAC Name | 4-chloro-2-N-[1-(2-fluorophenyl)ethyl]-2-N-methylbenzene-1,2-diamine |
| SMILES | CC(c1ccccc1F)N(C)c1cc(Cl)ccc1N |
| InChI | InChI=1S/C15H16ClFN2/c1-10(12-5-3-4-6-13(12)17)19(2)15-9-11(16)7-8-14(15)18/h3-10H,18H2,1-2H3 |
| InChIKey | GCQDJUUBOPCFOS-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.76 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|