C14H18ClN3S — CID 115469962
5-chloro-3-(1-pyrrolidin-1-ylpropan-2-yl)-1H-benzimidazole-2-thione (PubChem CID 115469962) has the molecular formula C14H18ClN3S and a molecular weight of 295.84 g/mol. Its IUPAC name is 5-chloro-3-(1-pyrrolidin-1-ylpropan-2-yl)-1H-benzimidazole-2-thione.
| Compound Name | 5-chloro-3-(1-pyrrolidin-1-ylpropan-2-yl)-1H-benzimidazole-2-thione |
|---|---|
| PubChem CID | 115469962 |
| Molecular Formula | C14H18ClN3S |
| Molecular Weight | 295.84 g/mol |
| Exact Mass | 295.09 |
| IUPAC Name | 5-chloro-3-(1-pyrrolidin-1-ylpropan-2-yl)-1H-benzimidazole-2-thione |
| SMILES | CC(CN1CCCC1)n1c(=S)[nH]c2ccc(Cl)cc21 |
| InChI | InChI=1S/C14H18ClN3S/c1-10(9-17-6-2-3-7-17)18-13-8-11(15)4-5-12(13)16-14(18)19/h4-5,8,10H,2-3,6-7,9H2,1H3,(H,16,19) |
| InChIKey | DFCWNFKSNLSQSL-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 23.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.84 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|