About 5-chloro-3-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-1H-benzimidazole-2-thione
5-chloro-3-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-1H-benzimidazole-2-thione (PubChem CID 115470175) has the molecular formula C13H12ClN3OS
and a molecular weight of 293.78 g/mol. Its IUPAC name is 5-chloro-3-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-1H-benzimidazole-2-thione.
Molecular Properties
| Compound Name | 5-chloro-3-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-1H-benzimidazole-2-thione |
| PubChem CID | 115470175 |
| Molecular Formula | C13H12ClN3OS |
| Molecular Weight | 293.78 g/mol |
| Exact Mass | 293.04 |
| IUPAC Name | 5-chloro-3-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-1H-benzimidazole-2-thione |
| SMILES | Cc1noc(C)c1Cn1c(=S)[nH]c2ccc(Cl)cc21 |
| InChI | InChI=1S/C13H12ClN3OS/c1-7-10(8(2)18-16-7)6-17-12-5-9(14)3-4-11(12)15-13(17)19/h3-5H,6H2,1-2H3,(H,15,19) |
| InChIKey | DEHKZOJBXFPEGQ-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 46.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.78 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 5-chloro-3-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-1H-benzimidazole-2-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-3-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-1H-benzimidazole-2-thione?
The IUPAC name of 5-chloro-3-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-1H-benzimidazole-2-thione (CID 115470175) is 5-chloro-3-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-1H-benzimidazole-2-thione.
What is the SMILES notation for 5-chloro-3-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-1H-benzimidazole-2-thione?
The canonical SMILES for 5-chloro-3-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-1H-benzimidazole-2-thione is Cc1noc(C)c1Cn1c(=S)[nH]c2ccc(Cl)cc21.
What is the InChIKey of 5-chloro-3-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-1H-benzimidazole-2-thione?
The InChIKey is DEHKZOJBXFPEGQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12ClN3OS/c1-7-10(8(2)18-16-7)6-17-12-5-9(14)3-4-11(12)15-13(17)19/h3-5H,6H2,1-2H3,(H,15,19).
What are the key properties of 5-chloro-3-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-1H-benzimidazole-2-thione?
5-chloro-3-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-1H-benzimidazole-2-thione has a molecular weight of 293.78 g/mol, XLogP of 4.01, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-3-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-1H-benzimidazole-2-thione is sourced from PubChem (CID 115470175), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).