C18H23Cl2N7O3 — CID 11547022
methyl 4-[4-[[amino-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]methylidene]amino]butyl]benzoate;hydrochloride (PubChem CID 11547022) has the molecular formula C18H23Cl2N7O3 and a molecular weight of 456.33 g/mol. Its IUPAC name is methyl 4-[4-[[amino-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]methylidene]amino]butyl]benzoate;hydrochloride.
| Compound Name | methyl 4-[4-[[amino-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]methylidene]amino]butyl]benzoate;hydrochloride |
|---|---|
| PubChem CID | 11547022 |
| Molecular Formula | C18H23Cl2N7O3 |
| Molecular Weight | 456.33 g/mol |
| Exact Mass | 455.12 |
| IUPAC Name | methyl 4-[4-[[amino-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]methylidene]amino]butyl]benzoate;hydrochloride |
| SMILES | COC(=O)c1ccc(CCCC/N=C(\N)NC(=O)c2nc(Cl)c(N)nc2N)cc1.Cl |
| InChI | InChI=1S/C18H22ClN7O3.ClH/c1-29-17(28)11-7-5-10(6-8-11)4-2-3-9-23-18(22)26-16(27)12-14(20)25-15(21)13(19)24-12;/h5-8H,2-4,9H2,1H3,(H4,20,21,25)(H3,22,23,26,27);1H |
| InChIKey | OFVLCOWPLTXCQX-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 171.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.33 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|