C15H18Cl2N2 — CID 115471068
6-chloro-2-(2-chloroethyl)-1-(cyclopentylmethyl)benzimidazole (PubChem CID 115471068) has the molecular formula C15H18Cl2N2 and a molecular weight of 297.23 g/mol. Its IUPAC name is 6-chloro-2-(2-chloroethyl)-1-(cyclopentylmethyl)benzimidazole.
| Compound Name | 6-chloro-2-(2-chloroethyl)-1-(cyclopentylmethyl)benzimidazole |
|---|---|
| PubChem CID | 115471068 |
| Molecular Formula | C15H18Cl2N2 |
| Molecular Weight | 297.23 g/mol |
| Exact Mass | 296.08 |
| IUPAC Name | 6-chloro-2-(2-chloroethyl)-1-(cyclopentylmethyl)benzimidazole |
| SMILES | ClCCc1nc2ccc(Cl)cc2n1CC1CCCC1 |
| InChI | InChI=1S/C15H18Cl2N2/c16-8-7-15-18-13-6-5-12(17)9-14(13)19(15)10-11-3-1-2-4-11/h5-6,9,11H,1-4,7-8,10H2 |
| InChIKey | FGCLHSHNTSRTNY-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.23 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|