C14H7Cl2F3N2 — CID 115471671
6-chloro-2-(chloromethyl)-1-(2,4,6-trifluorophenyl)benzimidazole (PubChem CID 115471671) has the molecular formula C14H7Cl2F3N2 and a molecular weight of 331.12 g/mol. Its IUPAC name is 6-chloro-2-(chloromethyl)-1-(2,4,6-trifluorophenyl)benzimidazole.
| Compound Name | 6-chloro-2-(chloromethyl)-1-(2,4,6-trifluorophenyl)benzimidazole |
|---|---|
| PubChem CID | 115471671 |
| Molecular Formula | C14H7Cl2F3N2 |
| Molecular Weight | 331.12 g/mol |
| Exact Mass | 329.99 |
| IUPAC Name | 6-chloro-2-(chloromethyl)-1-(2,4,6-trifluorophenyl)benzimidazole |
| SMILES | Fc1cc(F)c(-n2c(CCl)nc3ccc(Cl)cc32)c(F)c1 |
| InChI | InChI=1S/C14H7Cl2F3N2/c15-6-13-20-11-2-1-7(16)3-12(11)21(13)14-9(18)4-8(17)5-10(14)19/h1-5H,6H2 |
| InChIKey | ADDXJXAAKFCIIF-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.12 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|