C15H19Cl2N3O — CID 115471690
2-[[6-chloro-2-(1-chloroethyl)benzimidazol-1-yl]methyl]-4-methylmorpholine (PubChem CID 115471690) has the molecular formula C15H19Cl2N3O and a molecular weight of 328.24 g/mol. Its IUPAC name is 2-[[6-chloro-2-(1-chloroethyl)benzimidazol-1-yl]methyl]-4-methylmorpholine.
| Compound Name | 2-[[6-chloro-2-(1-chloroethyl)benzimidazol-1-yl]methyl]-4-methylmorpholine |
|---|---|
| PubChem CID | 115471690 |
| Molecular Formula | C15H19Cl2N3O |
| Molecular Weight | 328.24 g/mol |
| Exact Mass | 327.09 |
| IUPAC Name | 2-[[6-chloro-2-(1-chloroethyl)benzimidazol-1-yl]methyl]-4-methylmorpholine |
| SMILES | CC(Cl)c1nc2ccc(Cl)cc2n1CC1CN(C)CCO1 |
| InChI | InChI=1S/C15H19Cl2N3O/c1-10(16)15-18-13-4-3-11(17)7-14(13)20(15)9-12-8-19(2)5-6-21-12/h3-4,7,10,12H,5-6,8-9H2,1-2H3 |
| InChIKey | XGHGVVVTGPIQAB-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 30.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.24 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|