C12H17ClN2 — CID 115472197
7-chloro-2-(2-methylpropyl)-1,2,3,4-tetrahydroquinoxaline (PubChem CID 115472197) has the molecular formula C12H17ClN2 and a molecular weight of 224.73 g/mol. Its IUPAC name is 7-chloro-2-(2-methylpropyl)-1,2,3,4-tetrahydroquinoxaline.
| Compound Name | 7-chloro-2-(2-methylpropyl)-1,2,3,4-tetrahydroquinoxaline |
|---|---|
| PubChem CID | 115472197 |
| Molecular Formula | C12H17ClN2 |
| Molecular Weight | 224.73 g/mol |
| Exact Mass | 224.11 |
| IUPAC Name | 7-chloro-2-(2-methylpropyl)-1,2,3,4-tetrahydroquinoxaline |
| SMILES | CC(C)CC1CNc2ccc(Cl)cc2N1 |
| InChI | InChI=1S/C12H17ClN2/c1-8(2)5-10-7-14-11-4-3-9(13)6-12(11)15-10/h3-4,6,8,10,14-15H,5,7H2,1-2H3 |
| InChIKey | JMCQDFFGWDGLJI-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.73 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |