C16H14ClN3 — CID 115472337
6-chloro-2-(2,3-dihydro-1H-indol-3-yl)-1-methylbenzimidazole (PubChem CID 115472337) has the molecular formula C16H14ClN3 and a molecular weight of 283.76 g/mol. Its IUPAC name is 6-chloro-2-(2,3-dihydro-1H-indol-3-yl)-1-methylbenzimidazole.
| Compound Name | 6-chloro-2-(2,3-dihydro-1H-indol-3-yl)-1-methylbenzimidazole |
|---|---|
| PubChem CID | 115472337 |
| Molecular Formula | C16H14ClN3 |
| Molecular Weight | 283.76 g/mol |
| Exact Mass | 283.09 |
| IUPAC Name | 6-chloro-2-(2,3-dihydro-1H-indol-3-yl)-1-methylbenzimidazole |
| SMILES | Cn1c(C2CNc3ccccc32)nc2ccc(Cl)cc21 |
| InChI | InChI=1S/C16H14ClN3/c1-20-15-8-10(17)6-7-14(15)19-16(20)12-9-18-13-5-3-2-4-11(12)13/h2-8,12,18H,9H2,1H3 |
| InChIKey | PBFPJTQYJIJZLU-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.76 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |