C15H12ClF2N3 — CID 115472738
5-(6-chloro-1-ethylbenzimidazol-2-yl)-2,4-difluoroaniline (PubChem CID 115472738) has the molecular formula C15H12ClF2N3 and a molecular weight of 307.73 g/mol. Its IUPAC name is 5-(6-chloro-1-ethylbenzimidazol-2-yl)-2,4-difluoroaniline.
| Compound Name | 5-(6-chloro-1-ethylbenzimidazol-2-yl)-2,4-difluoroaniline |
|---|---|
| PubChem CID | 115472738 |
| Molecular Formula | C15H12ClF2N3 |
| Molecular Weight | 307.73 g/mol |
| Exact Mass | 307.07 |
| IUPAC Name | 5-(6-chloro-1-ethylbenzimidazol-2-yl)-2,4-difluoroaniline |
| SMILES | CCn1c(-c2cc(N)c(F)cc2F)nc2ccc(Cl)cc21 |
| InChI | InChI=1S/C15H12ClF2N3/c1-2-21-14-5-8(16)3-4-13(14)20-15(21)9-6-12(19)11(18)7-10(9)17/h3-7H,2,19H2,1H3 |
| InChIKey | XXBBWNULIOGXRT-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.73 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|