About 3-methylspiro[[1]benzothiolo[3,2-b]pyrrole-2,1'-cyclopentane]
3-methylspiro[[1]benzothiolo[3,2-b]pyrrole-2,1'-cyclopentane] (PubChem CID 11547303) has the molecular formula C15H15NS
and a molecular weight of 241.36 g/mol. Its IUPAC name is 3-methylspiro[[1]benzothiolo[3,2-b]pyrrole-2,1'-cyclopentane].
Molecular Properties
| Compound Name | 3-methylspiro[[1]benzothiolo[3,2-b]pyrrole-2,1'-cyclopentane] |
| PubChem CID | 11547303 |
| Molecular Formula | C15H15NS |
| Molecular Weight | 241.36 g/mol |
| Exact Mass | 241.09 |
| IUPAC Name | 3-methylspiro[[1]benzothiolo[3,2-b]pyrrole-2,1'-cyclopentane] |
| SMILES | CC1=c2sc3ccccc3c2=NC12CCCC2 |
| InChI | InChI=1S/C15H15NS/c1-10-14-13(16-15(10)8-4-5-9-15)11-6-2-3-7-12(11)17-14/h2-3,6-7H,4-5,8-9H2,1H3 |
| InChIKey | HOPUUKXIYVYUND-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.36 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-methylspiro[[1]benzothiolo[3,2-b]pyrrole-2,1'-cyclopentane] with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methylspiro[[1]benzothiolo[3,2-b]pyrrole-2,1'-cyclopentane]?
The IUPAC name of 3-methylspiro[[1]benzothiolo[3,2-b]pyrrole-2,1'-cyclopentane] (CID 11547303) is 3-methylspiro[[1]benzothiolo[3,2-b]pyrrole-2,1'-cyclopentane].
What is the SMILES notation for 3-methylspiro[[1]benzothiolo[3,2-b]pyrrole-2,1'-cyclopentane]?
The canonical SMILES for 3-methylspiro[[1]benzothiolo[3,2-b]pyrrole-2,1'-cyclopentane] is CC1=c2sc3ccccc3c2=NC12CCCC2.
What is the InChIKey of 3-methylspiro[[1]benzothiolo[3,2-b]pyrrole-2,1'-cyclopentane]?
The InChIKey is HOPUUKXIYVYUND-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15NS/c1-10-14-13(16-15(10)8-4-5-9-15)11-6-2-3-7-12(11)17-14/h2-3,6-7H,4-5,8-9H2,1H3.
What are the key properties of 3-methylspiro[[1]benzothiolo[3,2-b]pyrrole-2,1'-cyclopentane]?
3-methylspiro[[1]benzothiolo[3,2-b]pyrrole-2,1'-cyclopentane] has a molecular weight of 241.36 g/mol, XLogP of 3.02, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methylspiro[[1]benzothiolo[3,2-b]pyrrole-2,1'-cyclopentane] is sourced from PubChem (CID 11547303), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).