C21H21Cl2FN6O2 — CID 11547471
4-[4-[6-amino-5-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-3-pyridinyl]pyrazol-1-yl]pyrrolidine-2-carboxamide (PubChem CID 11547471) has the molecular formula C21H21Cl2FN6O2 and a molecular weight of 479.34 g/mol. Its IUPAC name is 4-[4-[6-amino-5-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-3-pyridinyl]pyrazol-1-yl]pyrrolidine-2-carboxamide.
| Compound Name | 4-[4-[6-amino-5-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-3-pyridinyl]pyrazol-1-yl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 11547471 |
| Molecular Formula | C21H21Cl2FN6O2 |
| Molecular Weight | 479.34 g/mol |
| Exact Mass | 478.11 |
| IUPAC Name | 4-[4-[6-amino-5-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-3-pyridinyl]pyrazol-1-yl]pyrrolidine-2-carboxamide |
| SMILES | CC(Oc1cc(-c2cnn(C3CNC(C(N)=O)C3)c2)cnc1N)c1c(Cl)ccc(F)c1Cl |
| InChI | InChI=1S/C21H21Cl2FN6O2/c1-10(18-14(22)2-3-15(24)19(18)23)32-17-4-11(6-28-20(17)25)12-7-29-30(9-12)13-5-16(21(26)31)27-8-13/h2-4,6-7,9-10,13,16,27H,5,8H2,1H3,(H2,25,28)(H2,26,31) |
| InChIKey | XROAFFUFCNIEKH-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 121.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.34 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|