C11H23N3O — CID 115474840
3-[[2-hydroxy-3-(2-methylpropylamino)propyl]-methylamino]propanenitrile (PubChem CID 115474840) has the molecular formula C11H23N3O and a molecular weight of 213.32 g/mol. Its IUPAC name is 3-[[2-hydroxy-3-(2-methylpropylamino)propyl]-methylamino]propanenitrile.
| Compound Name | 3-[[2-hydroxy-3-(2-methylpropylamino)propyl]-methylamino]propanenitrile |
|---|---|
| PubChem CID | 115474840 |
| Molecular Formula | C11H23N3O |
| Molecular Weight | 213.32 g/mol |
| Exact Mass | 213.18 |
| IUPAC Name | 3-[[2-hydroxy-3-(2-methylpropylamino)propyl]-methylamino]propanenitrile |
| SMILES | CC(C)CNCC(O)CN(C)CCC#N |
| InChI | InChI=1S/C11H23N3O/c1-10(2)7-13-8-11(15)9-14(3)6-4-5-12/h10-11,13,15H,4,6-9H2,1-3H3 |
| InChIKey | AZODWGXPPTVFHL-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 59.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.32 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |