C13H28N2O2 — CID 115475087
1-(tert-butylamino)-3-[cyclopropyl(2-methoxyethyl)amino]propan-2-ol (PubChem CID 115475087) has the molecular formula C13H28N2O2 and a molecular weight of 244.38 g/mol. Its IUPAC name is 1-(tert-butylamino)-3-[cyclopropyl(2-methoxyethyl)amino]propan-2-ol.
| Compound Name | 1-(tert-butylamino)-3-[cyclopropyl(2-methoxyethyl)amino]propan-2-ol |
|---|---|
| PubChem CID | 115475087 |
| Molecular Formula | C13H28N2O2 |
| Molecular Weight | 244.38 g/mol |
| Exact Mass | 244.22 |
| IUPAC Name | 1-(tert-butylamino)-3-[cyclopropyl(2-methoxyethyl)amino]propan-2-ol |
| SMILES | COCCN(CC(O)CNC(C)(C)C)C1CC1 |
| InChI | InChI=1S/C13H28N2O2/c1-13(2,3)14-9-12(16)10-15(7-8-17-4)11-5-6-11/h11-12,14,16H,5-10H2,1-4H3 |
| InChIKey | LVPQGLBPZKCYJO-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 44.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.38 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |