C13H25F3N2O — CID 115475413
1-(2-methylpropylamino)-3-[4-(trifluoromethyl)piperidin-1-yl]propan-2-ol (PubChem CID 115475413) has the molecular formula C13H25F3N2O and a molecular weight of 282.35 g/mol. Its IUPAC name is 1-(2-methylpropylamino)-3-[4-(trifluoromethyl)piperidin-1-yl]propan-2-ol.
| Compound Name | 1-(2-methylpropylamino)-3-[4-(trifluoromethyl)piperidin-1-yl]propan-2-ol |
|---|---|
| PubChem CID | 115475413 |
| Molecular Formula | C13H25F3N2O |
| Molecular Weight | 282.35 g/mol |
| Exact Mass | 282.19 |
| IUPAC Name | 1-(2-methylpropylamino)-3-[4-(trifluoromethyl)piperidin-1-yl]propan-2-ol |
| SMILES | CC(C)CNCC(O)CN1CCC(C(F)(F)F)CC1 |
| InChI | InChI=1S/C13H25F3N2O/c1-10(2)7-17-8-12(19)9-18-5-3-11(4-6-18)13(14,15)16/h10-12,17,19H,3-9H2,1-2H3 |
| InChIKey | WBONBACBYWKFTN-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.35 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |