C12H18BrN3O4 — CID 115475666
5-bromo-1-[3-(tert-butylamino)-2-hydroxypropyl]-3-nitropyridin-2-one (PubChem CID 115475666) has the molecular formula C12H18BrN3O4 and a molecular weight of 348.20 g/mol. Its IUPAC name is 5-bromo-1-[3-(tert-butylamino)-2-hydroxypropyl]-3-nitropyridin-2-one.
| Compound Name | 5-bromo-1-[3-(tert-butylamino)-2-hydroxypropyl]-3-nitropyridin-2-one |
|---|---|
| PubChem CID | 115475666 |
| Molecular Formula | C12H18BrN3O4 |
| Molecular Weight | 348.20 g/mol |
| Exact Mass | 347.05 |
| IUPAC Name | 5-bromo-1-[3-(tert-butylamino)-2-hydroxypropyl]-3-nitropyridin-2-one |
| SMILES | CC(C)(C)NCC(O)Cn1cc(Br)cc([N+](=O)[O-])c1=O |
| InChI | InChI=1S/C12H18BrN3O4/c1-12(2,3)14-5-9(17)7-15-6-8(13)4-10(11(15)18)16(19)20/h4,6,9,14,17H,5,7H2,1-3H3 |
| InChIKey | YSLSKFILYIPUEC-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 97.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.20 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|