C25H44O7Si — CID 11547584
methyl 2-[(1S,2S,6R,7R,9S,12R)-7-[(1S)-1-[tert-butyl(dimethyl)silyl]oxyprop-2-enyl]-4,4-diethyl-3,5,8,13-tetraoxatricyclo[7.4.0.02,6]tridecan-12-yl]acetate (PubChem CID 11547584) has the molecular formula C25H44O7Si and a molecular weight of 484.71 g/mol. Its IUPAC name is methyl 2-[(1S,2S,6R,7R,9S,12R)-7-[(1S)-1-[tert-butyl(dimethyl)silyl]oxyprop-2-enyl]-4,4-diethyl-3,5,8,13-tetraoxatricyclo[7.4.0.02,6]tridecan-12-yl]acetate.
| Compound Name | methyl 2-[(1S,2S,6R,7R,9S,12R)-7-[(1S)-1-[tert-butyl(dimethyl)silyl]oxyprop-2-enyl]-4,4-diethyl-3,5,8,13-tetraoxatricyclo[7.4.0.02,6]tridecan-12-yl]acetate |
|---|---|
| PubChem CID | 11547584 |
| Molecular Formula | C25H44O7Si |
| Molecular Weight | 484.71 g/mol |
| Exact Mass | 484.29 |
| IUPAC Name | methyl 2-[(1S,2S,6R,7R,9S,12R)-7-[(1S)-1-[tert-butyl(dimethyl)silyl]oxyprop-2-enyl]-4,4-diethyl-3,5,8,13-tetraoxatricyclo[7.4.0.02,6]tridecan-12-yl]acetate |
| SMILES | C=C[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O[C@H]2CC[C@H](CC(=O)OC)O[C@@H]2[C@@H]2OC(CC)(CC)O[C@@H]21 |
| InChI | InChI=1S/C25H44O7Si/c1-10-17(32-33(8,9)24(4,5)6)20-22-23(31-25(11-2,12-3)30-22)21-18(29-20)14-13-16(28-21)15-19(26)27-7/h10,16-18,20-23H,1,11-15H2,2-9H3/t16-,17+,18+,20+,21+,22-,23+/m1/s1 |
| InChIKey | GWCHPFDAGHCLMG-UWYAYLEVSA-N |
| XLogP | 4.74 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.71 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|