C22H10F4O7S — CID 11547750
4-(carboxymethylsulfanyl)-2,3,5-trifluoro-6-(2-fluoro-3-hydroxy-6-oxoxanthen-9-yl)benzoic acid (PubChem CID 11547750) has the molecular formula C22H10F4O7S and a molecular weight of 494.37 g/mol. Its IUPAC name is 4-(carboxymethylsulfanyl)-2,3,5-trifluoro-6-(2-fluoro-3-hydroxy-6-oxoxanthen-9-yl)benzoic acid.
| Compound Name | 4-(carboxymethylsulfanyl)-2,3,5-trifluoro-6-(2-fluoro-3-hydroxy-6-oxoxanthen-9-yl)benzoic acid |
|---|---|
| PubChem CID | 11547750 |
| Molecular Formula | C22H10F4O7S |
| Molecular Weight | 494.37 g/mol |
| Exact Mass | 494.01 |
| IUPAC Name | 4-(carboxymethylsulfanyl)-2,3,5-trifluoro-6-(2-fluoro-3-hydroxy-6-oxoxanthen-9-yl)benzoic acid |
| SMILES | O=C(O)CSc1c(F)c(F)c(C(=O)O)c(-c2c3ccc(=O)cc-3oc3cc(O)c(F)cc23)c1F |
| InChI | InChI=1S/C22H10F4O7S/c23-10-4-9-13(5-11(10)28)33-12-3-7(27)1-2-8(12)15(9)16-17(22(31)32)18(24)20(26)21(19(16)25)34-6-14(29)30/h1-5,28H,6H2,(H,29,30)(H,31,32) |
| InChIKey | WOGODTTWAJOAAN-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 125.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.37 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|