C14H8Cl2FNOS — CID 115477749
3-[(2,6-dichlorophenyl)sulfinylmethyl]-5-fluorobenzonitrile (PubChem CID 115477749) has the molecular formula C14H8Cl2FNOS and a molecular weight of 328.20 g/mol. Its IUPAC name is 3-[(2,6-dichlorophenyl)sulfinylmethyl]-5-fluorobenzonitrile.
| Compound Name | 3-[(2,6-dichlorophenyl)sulfinylmethyl]-5-fluorobenzonitrile |
|---|---|
| PubChem CID | 115477749 |
| Molecular Formula | C14H8Cl2FNOS |
| Molecular Weight | 328.20 g/mol |
| Exact Mass | 326.97 |
| IUPAC Name | 3-[(2,6-dichlorophenyl)sulfinylmethyl]-5-fluorobenzonitrile |
| SMILES | N#Cc1cc(F)cc(CS(=O)c2c(Cl)cccc2Cl)c1 |
| InChI | InChI=1S/C14H8Cl2FNOS/c15-12-2-1-3-13(16)14(12)20(19)8-10-4-9(7-18)5-11(17)6-10/h1-6H,8H2 |
| InChIKey | ZBKGGLKPNUKGJM-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 40.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.20 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |