C26H29F2N5OS — CID 11547799
[4-amino-2-[4-(4-piperidin-1-ylpiperidin-1-yl)anilino]-1,3-thiazol-5-yl]-(3,4-difluorophenyl)methanone (PubChem CID 11547799) has the molecular formula C26H29F2N5OS and a molecular weight of 497.62 g/mol. Its IUPAC name is [4-amino-2-[4-(4-piperidin-1-ylpiperidin-1-yl)anilino]-1,3-thiazol-5-yl]-(3,4-difluorophenyl)methanone.
| Compound Name | [4-amino-2-[4-(4-piperidin-1-ylpiperidin-1-yl)anilino]-1,3-thiazol-5-yl]-(3,4-difluorophenyl)methanone |
|---|---|
| PubChem CID | 11547799 |
| Molecular Formula | C26H29F2N5OS |
| Molecular Weight | 497.62 g/mol |
| Exact Mass | 497.21 |
| IUPAC Name | [4-amino-2-[4-(4-piperidin-1-ylpiperidin-1-yl)anilino]-1,3-thiazol-5-yl]-(3,4-difluorophenyl)methanone |
| SMILES | Nc1nc(Nc2ccc(N3CCC(N4CCCCC4)CC3)cc2)sc1C(=O)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C26H29F2N5OS/c27-21-9-4-17(16-22(21)28)23(34)24-25(29)31-26(35-24)30-18-5-7-19(8-6-18)33-14-10-20(11-15-33)32-12-2-1-3-13-32/h4-9,16,20H,1-3,10-15,29H2,(H,30,31) |
| InChIKey | KRRCMKMBYCJRJR-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 74.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.62 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|