C11H13N3O3S — CID 115478815
6-(3-azidopropylsulfinyl)-2,3-dihydro-1,4-benzodioxine (PubChem CID 115478815) has the molecular formula C11H13N3O3S and a molecular weight of 267.31 g/mol. Its IUPAC name is 6-(3-azidopropylsulfinyl)-2,3-dihydro-1,4-benzodioxine.
| Compound Name | 6-(3-azidopropylsulfinyl)-2,3-dihydro-1,4-benzodioxine |
|---|---|
| PubChem CID | 115478815 |
| Molecular Formula | C11H13N3O3S |
| Molecular Weight | 267.31 g/mol |
| Exact Mass | 267.07 |
| IUPAC Name | 6-(3-azidopropylsulfinyl)-2,3-dihydro-1,4-benzodioxine |
| SMILES | [N-]=[N+]=NCCCS(=O)c1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C11H13N3O3S/c12-14-13-4-1-7-18(15)9-2-3-10-11(8-9)17-6-5-16-10/h2-3,8H,1,4-7H2 |
| InChIKey | SXKIGBUZIAEZNY-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 84.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.31 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|