C17H25NO2S — CID 115479022
N-[2-(2,3-dihydro-1,4-benzodioxin-6-ylsulfanyl)ethyl]-3-methylcyclohexan-1-amine (PubChem CID 115479022) has the molecular formula C17H25NO2S and a molecular weight of 307.46 g/mol. Its IUPAC name is N-[2-(2,3-dihydro-1,4-benzodioxin-6-ylsulfanyl)ethyl]-3-methylcyclohexan-1-amine.
| Compound Name | N-[2-(2,3-dihydro-1,4-benzodioxin-6-ylsulfanyl)ethyl]-3-methylcyclohexan-1-amine |
|---|---|
| PubChem CID | 115479022 |
| Molecular Formula | C17H25NO2S |
| Molecular Weight | 307.46 g/mol |
| Exact Mass | 307.16 |
| IUPAC Name | N-[2-(2,3-dihydro-1,4-benzodioxin-6-ylsulfanyl)ethyl]-3-methylcyclohexan-1-amine |
| SMILES | CC1CCCC(NCCSc2ccc3c(c2)OCCO3)C1 |
| InChI | InChI=1S/C17H25NO2S/c1-13-3-2-4-14(11-13)18-7-10-21-15-5-6-16-17(12-15)20-9-8-19-16/h5-6,12-14,18H,2-4,7-11H2,1H3 |
| InChIKey | KFUPGAJPEPPZNL-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.46 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|