C26H29F2N5O2S — CID 11548030
[4-amino-2-[4-[4-(3-hydroxypiperidin-1-yl)piperidin-1-yl]anilino]-1,3-thiazol-5-yl]-(3,4-difluorophenyl)methanone (PubChem CID 11548030) has the molecular formula C26H29F2N5O2S and a molecular weight of 513.61 g/mol. Its IUPAC name is [4-amino-2-[4-[4-(3-hydroxypiperidin-1-yl)piperidin-1-yl]anilino]-1,3-thiazol-5-yl]-(3,4-difluorophenyl)methanone.
| Compound Name | [4-amino-2-[4-[4-(3-hydroxypiperidin-1-yl)piperidin-1-yl]anilino]-1,3-thiazol-5-yl]-(3,4-difluorophenyl)methanone |
|---|---|
| PubChem CID | 11548030 |
| Molecular Formula | C26H29F2N5O2S |
| Molecular Weight | 513.61 g/mol |
| Exact Mass | 513.20 |
| IUPAC Name | [4-amino-2-[4-[4-(3-hydroxypiperidin-1-yl)piperidin-1-yl]anilino]-1,3-thiazol-5-yl]-(3,4-difluorophenyl)methanone |
| SMILES | Nc1nc(Nc2ccc(N3CCC(N4CCCC(O)C4)CC3)cc2)sc1C(=O)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C26H29F2N5O2S/c27-21-8-3-16(14-22(21)28)23(35)24-25(29)31-26(36-24)30-17-4-6-18(7-5-17)32-12-9-19(10-13-32)33-11-1-2-20(34)15-33/h3-8,14,19-20,34H,1-2,9-13,15,29H2,(H,30,31) |
| InChIKey | ZESXTGGUEWKERA-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 94.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.61 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|