C32H37NO5 — CID 11548060
(2R,3S)-2-[(3aR,5R,6S,6aR)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-1-benzyl-3-phenylmethoxypyrrolidine (PubChem CID 11548060) has the molecular formula C32H37NO5 and a molecular weight of 515.65 g/mol. Its IUPAC name is (2R,3S)-2-[(3aR,5R,6S,6aR)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-1-benzyl-3-phenylmethoxypyrrolidine.
| Compound Name | (2R,3S)-2-[(3aR,5R,6S,6aR)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-1-benzyl-3-phenylmethoxypyrrolidine |
|---|---|
| PubChem CID | 11548060 |
| Molecular Formula | C32H37NO5 |
| Molecular Weight | 515.65 g/mol |
| Exact Mass | 515.27 |
| IUPAC Name | (2R,3S)-2-[(3aR,5R,6S,6aR)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-1-benzyl-3-phenylmethoxypyrrolidine |
| SMILES | CC1(C)O[C@H]2O[C@H]([C@H]3[C@@H](OCc4ccccc4)CCN3Cc3ccccc3)[C@H](OCc3ccccc3)[C@H]2O1 |
| InChI | InChI=1S/C32H37NO5/c1-32(2)37-30-29(35-22-25-16-10-5-11-17-25)28(36-31(30)38-32)27-26(34-21-24-14-8-4-9-15-24)18-19-33(27)20-23-12-6-3-7-13-23/h3-17,26-31H,18-22H2,1-2H3/t26-,27+,28+,29-,30+,31+/m0/s1 |
| InChIKey | DHUBXQZEINYRQN-YKXTZOJHSA-N |
| XLogP | 5.31 |
| TPSA | 49.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.65 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |