About ethyl 5-(4,4,4-trifluorobutylsulfamoyl)-1H-pyrazole-4-carboxylate
ethyl 5-(4,4,4-trifluorobutylsulfamoyl)-1H-pyrazole-4-carboxylate (PubChem CID 115480607) has the molecular formula C10H14F3N3O4S
and a molecular weight of 329.30 g/mol. Its IUPAC name is ethyl 5-(4,4,4-trifluorobutylsulfamoyl)-1H-pyrazole-4-carboxylate.
Molecular Properties
| Compound Name | ethyl 5-(4,4,4-trifluorobutylsulfamoyl)-1H-pyrazole-4-carboxylate |
| PubChem CID | 115480607 |
| Molecular Formula | C10H14F3N3O4S |
| Molecular Weight | 329.30 g/mol |
| Exact Mass | 329.07 |
| IUPAC Name | ethyl 5-(4,4,4-trifluorobutylsulfamoyl)-1H-pyrazole-4-carboxylate |
| SMILES | CCOC(=O)c1cn[nH]c1S(=O)(=O)NCCCC(F)(F)F |
| InChI | InChI=1S/C10H14F3N3O4S/c1-2-20-9(17)7-6-14-16-8(7)21(18,19)15-5-3-4-10(11,12)13/h6,15H,2-5H2,1H3,(H,14,16) |
| InChIKey | NCUPOBVVTDANIG-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 101.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.30 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze ethyl 5-(4,4,4-trifluorobutylsulfamoyl)-1H-pyrazole-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 5-(4,4,4-trifluorobutylsulfamoyl)-1H-pyrazole-4-carboxylate?
The IUPAC name of ethyl 5-(4,4,4-trifluorobutylsulfamoyl)-1H-pyrazole-4-carboxylate (CID 115480607) is ethyl 5-(4,4,4-trifluorobutylsulfamoyl)-1H-pyrazole-4-carboxylate.
What is the SMILES notation for ethyl 5-(4,4,4-trifluorobutylsulfamoyl)-1H-pyrazole-4-carboxylate?
The canonical SMILES for ethyl 5-(4,4,4-trifluorobutylsulfamoyl)-1H-pyrazole-4-carboxylate is CCOC(=O)c1cn[nH]c1S(=O)(=O)NCCCC(F)(F)F.
What is the InChIKey of ethyl 5-(4,4,4-trifluorobutylsulfamoyl)-1H-pyrazole-4-carboxylate?
The InChIKey is NCUPOBVVTDANIG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14F3N3O4S/c1-2-20-9(17)7-6-14-16-8(7)21(18,19)15-5-3-4-10(11,12)13/h6,15H,2-5H2,1H3,(H,14,16).
What are the key properties of ethyl 5-(4,4,4-trifluorobutylsulfamoyl)-1H-pyrazole-4-carboxylate?
ethyl 5-(4,4,4-trifluorobutylsulfamoyl)-1H-pyrazole-4-carboxylate has a molecular weight of 329.30 g/mol, XLogP of 1.21, 7 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 5-(4,4,4-trifluorobutylsulfamoyl)-1H-pyrazole-4-carboxylate is sourced from PubChem (CID 115480607), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).