C13H24O4 — CID 115480775
4-(diethoxymethyl)-2,2,5,5-tetramethyloxolan-3-one (PubChem CID 115480775) has the molecular formula C13H24O4 and a molecular weight of 244.33 g/mol. Its IUPAC name is 4-(diethoxymethyl)-2,2,5,5-tetramethyloxolan-3-one.
| Compound Name | 4-(diethoxymethyl)-2,2,5,5-tetramethyloxolan-3-one |
|---|---|
| PubChem CID | 115480775 |
| Molecular Formula | C13H24O4 |
| Molecular Weight | 244.33 g/mol |
| Exact Mass | 244.17 |
| IUPAC Name | 4-(diethoxymethyl)-2,2,5,5-tetramethyloxolan-3-one |
| SMILES | CCOC(OCC)C1C(=O)C(C)(C)OC1(C)C |
| InChI | InChI=1S/C13H24O4/c1-7-15-11(16-8-2)9-10(14)13(5,6)17-12(9,3)4/h9,11H,7-8H2,1-6H3 |
| InChIKey | KKUAVBZUEKLZKB-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.33 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|