C23H17ClF6N2O3 — CID 11548102
2-[1-[[2-(2-chlorophenyl)-5-(hydroxymethyl)-1,3-oxazol-4-yl]methyl]-2-methylindol-5-yl]-1,1,1,3,3,3-hexafluoropropan-2-ol (PubChem CID 11548102) has the molecular formula C23H17ClF6N2O3 and a molecular weight of 518.84 g/mol. Its IUPAC name is 2-[1-[[2-(2-chlorophenyl)-5-(hydroxymethyl)-1,3-oxazol-4-yl]methyl]-2-methylindol-5-yl]-1,1,1,3,3,3-hexafluoropropan-2-ol.
| Compound Name | 2-[1-[[2-(2-chlorophenyl)-5-(hydroxymethyl)-1,3-oxazol-4-yl]methyl]-2-methylindol-5-yl]-1,1,1,3,3,3-hexafluoropropan-2-ol |
|---|---|
| PubChem CID | 11548102 |
| Molecular Formula | C23H17ClF6N2O3 |
| Molecular Weight | 518.84 g/mol |
| Exact Mass | 518.08 |
| IUPAC Name | 2-[1-[[2-(2-chlorophenyl)-5-(hydroxymethyl)-1,3-oxazol-4-yl]methyl]-2-methylindol-5-yl]-1,1,1,3,3,3-hexafluoropropan-2-ol |
| SMILES | Cc1cc2cc(C(O)(C(F)(F)F)C(F)(F)F)ccc2n1Cc1nc(-c2ccccc2Cl)oc1CO |
| InChI | InChI=1S/C23H17ClF6N2O3/c1-12-8-13-9-14(21(34,22(25,26)27)23(28,29)30)6-7-18(13)32(12)10-17-19(11-33)35-20(31-17)15-4-2-3-5-16(15)24/h2-9,33-34H,10-11H2,1H3 |
| InChIKey | FSUKVQVCZZXHDO-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 71.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.84 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |