C19H22O — CID 115481860
(3,4-diethylphenyl)-(2,3-dimethylphenyl)methanone (PubChem CID 115481860) has the molecular formula C19H22O and a molecular weight of 266.38 g/mol. Its IUPAC name is (3,4-diethylphenyl)-(2,3-dimethylphenyl)methanone.
| Compound Name | (3,4-diethylphenyl)-(2,3-dimethylphenyl)methanone |
|---|---|
| PubChem CID | 115481860 |
| Molecular Formula | C19H22O |
| Molecular Weight | 266.38 g/mol |
| Exact Mass | 266.17 |
| IUPAC Name | (3,4-diethylphenyl)-(2,3-dimethylphenyl)methanone |
| SMILES | CCc1ccc(C(=O)c2cccc(C)c2C)cc1CC |
| InChI | InChI=1S/C19H22O/c1-5-15-10-11-17(12-16(15)6-2)19(20)18-9-7-8-13(3)14(18)4/h7-12H,5-6H2,1-4H3 |
| InChIKey | PQCDMSQWQBHOJD-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.38 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |