C20H35N — CID 115482264
1-(3,4-diethylphenyl)-N-methylnonan-1-amine (PubChem CID 115482264) has the molecular formula C20H35N and a molecular weight of 289.51 g/mol. Its IUPAC name is 1-(3,4-diethylphenyl)-N-methylnonan-1-amine.
| Compound Name | 1-(3,4-diethylphenyl)-N-methylnonan-1-amine |
|---|---|
| PubChem CID | 115482264 |
| Molecular Formula | C20H35N |
| Molecular Weight | 289.51 g/mol |
| Exact Mass | 289.28 |
| IUPAC Name | 1-(3,4-diethylphenyl)-N-methylnonan-1-amine |
| SMILES | CCCCCCCCC(NC)c1ccc(CC)c(CC)c1 |
| InChI | InChI=1S/C20H35N/c1-5-8-9-10-11-12-13-20(21-4)19-15-14-17(6-2)18(7-3)16-19/h14-16,20-21H,5-13H2,1-4H3 |
| InChIKey | FCLGUWBPLCQYNB-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.51 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|