C26H27F7N2O2 — CID 11548281
(3R,5R)-3-amino-5-[(1R,2R,3S)-3-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-2-(4-fluorophenyl)cyclopentyl]-3-methylpyrrolidin-2-one (PubChem CID 11548281) has the molecular formula C26H27F7N2O2 and a molecular weight of 532.50 g/mol. Its IUPAC name is (3R,5R)-3-amino-5-[(1R,2R,3S)-3-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-2-(4-fluorophenyl)cyclopentyl]-3-methylpyrrolidin-2-one.
| Compound Name | (3R,5R)-3-amino-5-[(1R,2R,3S)-3-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-2-(4-fluorophenyl)cyclopentyl]-3-methylpyrrolidin-2-one |
|---|---|
| PubChem CID | 11548281 |
| Molecular Formula | C26H27F7N2O2 |
| Molecular Weight | 532.50 g/mol |
| Exact Mass | 532.20 |
| IUPAC Name | (3R,5R)-3-amino-5-[(1R,2R,3S)-3-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-2-(4-fluorophenyl)cyclopentyl]-3-methylpyrrolidin-2-one |
| SMILES | C[C@@H](O[C@H]1CC[C@@H]([C@H]2C[C@@](C)(N)C(=O)N2)[C@@H]1c1ccc(F)cc1)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C26H27F7N2O2/c1-13(15-9-16(25(28,29)30)11-17(10-15)26(31,32)33)37-21-8-7-19(20-12-24(2,34)23(36)35-20)22(21)14-3-5-18(27)6-4-14/h3-6,9-11,13,19-22H,7-8,12,34H2,1-2H3,(H,35,36)/t13-,19+,20-,21+,22+,24-/m1/s1 |
| InChIKey | KZTCESBCLZIDIQ-UBIRSAPJSA-N |
| XLogP | 6.11 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.50 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |