C15H16Br2O — CID 115483045
2-bromo-5-[bromo-(3,4-diethylphenyl)methyl]furan (PubChem CID 115483045) has the molecular formula C15H16Br2O and a molecular weight of 372.10 g/mol. Its IUPAC name is 2-bromo-5-[bromo-(3,4-diethylphenyl)methyl]furan.
| Compound Name | 2-bromo-5-[bromo-(3,4-diethylphenyl)methyl]furan |
|---|---|
| PubChem CID | 115483045 |
| Molecular Formula | C15H16Br2O |
| Molecular Weight | 372.10 g/mol |
| Exact Mass | 369.96 |
| IUPAC Name | 2-bromo-5-[bromo-(3,4-diethylphenyl)methyl]furan |
| SMILES | CCc1ccc(C(Br)c2ccc(Br)o2)cc1CC |
| InChI | InChI=1S/C15H16Br2O/c1-3-10-5-6-12(9-11(10)4-2)15(17)13-7-8-14(16)18-13/h5-9,15H,3-4H2,1-2H3 |
| InChIKey | GFXIREADTUOIIM-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.10 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|