C15H20O — CID 115483213
(1R)-4-methyl-1,2,3,4,5,6,7,8-octahydroanthracen-1-ol (PubChem CID 115483213) has the molecular formula C15H20O and a molecular weight of 216.32 g/mol. Its IUPAC name is (1R)-4-methyl-1,2,3,4,5,6,7,8-octahydroanthracen-1-ol.
| Compound Name | (1R)-4-methyl-1,2,3,4,5,6,7,8-octahydroanthracen-1-ol |
|---|---|
| PubChem CID | 115483213 |
| Molecular Formula | C15H20O |
| Molecular Weight | 216.32 g/mol |
| Exact Mass | 216.15 |
| IUPAC Name | (1R)-4-methyl-1,2,3,4,5,6,7,8-octahydroanthracen-1-ol |
| SMILES | CC1CC[C@@H](O)c2cc3c(cc21)CCCC3 |
| InChI | InChI=1S/C15H20O/c1-10-6-7-15(16)14-9-12-5-3-2-4-11(12)8-13(10)14/h8-10,15-16H,2-7H2,1H3/t10?,15-/m1/s1 |
| InChIKey | MZCDSPHQMBWXIQ-GENIYJEYSA-N |
| XLogP | 3.50 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.32 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |