C15H22O — CID 115483246
(1S)-6,7-diethyl-4-methyl-1,2,3,4-tetrahydronaphthalen-1-ol (PubChem CID 115483246) has the molecular formula C15H22O and a molecular weight of 218.34 g/mol. Its IUPAC name is (1S)-6,7-diethyl-4-methyl-1,2,3,4-tetrahydronaphthalen-1-ol.
| Compound Name | (1S)-6,7-diethyl-4-methyl-1,2,3,4-tetrahydronaphthalen-1-ol |
|---|---|
| PubChem CID | 115483246 |
| Molecular Formula | C15H22O |
| Molecular Weight | 218.34 g/mol |
| Exact Mass | 218.17 |
| IUPAC Name | (1S)-6,7-diethyl-4-methyl-1,2,3,4-tetrahydronaphthalen-1-ol |
| SMILES | CCc1cc2c(cc1CC)[C@@H](O)CCC2C |
| InChI | InChI=1S/C15H22O/c1-4-11-8-13-10(3)6-7-15(16)14(13)9-12(11)5-2/h8-10,15-16H,4-7H2,1-3H3/t10?,15-/m0/s1 |
| InChIKey | YTCLJVOSEJSGAW-WRXSAAJRSA-N |
| XLogP | 3.74 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.34 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |