C28H24BrClN2O4 — CID 11548655
3-(4-chlorophenyl)-1-(3,4-dimethoxyphenyl)-9,10-dimethoxypyrazino[2,1-a]isoquinolin-5-ium bromide (PubChem CID 11548655) has the molecular formula C28H24BrClN2O4 and a molecular weight of 567.87 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-1-(3,4-dimethoxyphenyl)-9,10-dimethoxypyrazino[2,1-a]isoquinolin-5-ium bromide.
| Compound Name | 3-(4-chlorophenyl)-1-(3,4-dimethoxyphenyl)-9,10-dimethoxypyrazino[2,1-a]isoquinolin-5-ium bromide |
|---|---|
| PubChem CID | 11548655 |
| Molecular Formula | C28H24BrClN2O4 |
| Molecular Weight | 567.87 g/mol |
| Exact Mass | 566.06 |
| IUPAC Name | 3-(4-chlorophenyl)-1-(3,4-dimethoxyphenyl)-9,10-dimethoxypyrazino[2,1-a]isoquinolin-5-ium bromide |
| SMILES | COc1ccc(-c2nc(-c3ccc(Cl)cc3)c[n+]3ccc4cc(OC)c(OC)cc4c23)cc1OC.[Br-] |
| InChI | InChI=1S/C28H24ClN2O4.BrH/c1-32-23-10-7-19(14-24(23)33-2)27-28-21-15-26(35-4)25(34-3)13-18(21)11-12-31(28)16-22(30-27)17-5-8-20(29)9-6-17;/h5-16H,1-4H3;1H/q+1;/p-1 |
| InChIKey | NGDFXBHTWGVYAY-UHFFFAOYSA-M |
| XLogP | 3.00 |
| TPSA | 53.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.87 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_B(2)', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|