C11H17F3N4O2 — CID 115486574
6-amino-1-ethyl-5-(5,5,5-trifluoropentylamino)pyrimidine-2,4-dione (PubChem CID 115486574) has the molecular formula C11H17F3N4O2 and a molecular weight of 294.28 g/mol. Its IUPAC name is 6-amino-1-ethyl-5-(5,5,5-trifluoropentylamino)pyrimidine-2,4-dione.
| Compound Name | 6-amino-1-ethyl-5-(5,5,5-trifluoropentylamino)pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 115486574 |
| Molecular Formula | C11H17F3N4O2 |
| Molecular Weight | 294.28 g/mol |
| Exact Mass | 294.13 |
| IUPAC Name | 6-amino-1-ethyl-5-(5,5,5-trifluoropentylamino)pyrimidine-2,4-dione |
| SMILES | CCn1c(N)c(NCCCCC(F)(F)F)c(=O)[nH]c1=O |
| InChI | InChI=1S/C11H17F3N4O2/c1-2-18-8(15)7(9(19)17-10(18)20)16-6-4-3-5-11(12,13)14/h16H,2-6,15H2,1H3,(H,17,19,20) |
| InChIKey | WZOFAHBPHRNNGG-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 92.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.28 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|