C10H12ClF3N2O2S — CID 115486605
methyl 4-chloro-2-(5,5,5-trifluoropentylamino)-1,3-thiazole-5-carboxylate (PubChem CID 115486605) has the molecular formula C10H12ClF3N2O2S and a molecular weight of 316.73 g/mol. Its IUPAC name is methyl 4-chloro-2-(5,5,5-trifluoropentylamino)-1,3-thiazole-5-carboxylate.
| Compound Name | methyl 4-chloro-2-(5,5,5-trifluoropentylamino)-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 115486605 |
| Molecular Formula | C10H12ClF3N2O2S |
| Molecular Weight | 316.73 g/mol |
| Exact Mass | 316.03 |
| IUPAC Name | methyl 4-chloro-2-(5,5,5-trifluoropentylamino)-1,3-thiazole-5-carboxylate |
| SMILES | COC(=O)c1sc(NCCCCC(F)(F)F)nc1Cl |
| InChI | InChI=1S/C10H12ClF3N2O2S/c1-18-8(17)6-7(11)16-9(19-6)15-5-3-2-4-10(12,13)14/h2-5H2,1H3,(H,15,16) |
| InChIKey | CMZKHTHCWCYQPB-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.73 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|