C10H12F3N5O — CID 115486623
6-(5,5,5-trifluoropentylamino)-2H-[1,2,4]triazolo[4,3-b]pyridazin-3-one (PubChem CID 115486623) has the molecular formula C10H12F3N5O and a molecular weight of 275.23 g/mol. Its IUPAC name is 6-(5,5,5-trifluoropentylamino)-2H-[1,2,4]triazolo[4,3-b]pyridazin-3-one.
| Compound Name | 6-(5,5,5-trifluoropentylamino)-2H-[1,2,4]triazolo[4,3-b]pyridazin-3-one |
|---|---|
| PubChem CID | 115486623 |
| Molecular Formula | C10H12F3N5O |
| Molecular Weight | 275.23 g/mol |
| Exact Mass | 275.10 |
| IUPAC Name | 6-(5,5,5-trifluoropentylamino)-2H-[1,2,4]triazolo[4,3-b]pyridazin-3-one |
| SMILES | O=c1[nH]nc2ccc(NCCCCC(F)(F)F)nn12 |
| InChI | InChI=1S/C10H12F3N5O/c11-10(12,13)5-1-2-6-14-7-3-4-8-15-16-9(19)18(8)17-7/h3-4H,1-2,5-6H2,(H,14,17)(H,16,19) |
| InChIKey | CVNXIMRVXHEHCC-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 75.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.23 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|