C9H12ClF3N2O2S2 — CID 115486666
2-chloro-4-methyl-N-(5,5,5-trifluoropentyl)-1,3-thiazole-5-sulfonamide (PubChem CID 115486666) has the molecular formula C9H12ClF3N2O2S2 and a molecular weight of 336.79 g/mol. Its IUPAC name is 2-chloro-4-methyl-N-(5,5,5-trifluoropentyl)-1,3-thiazole-5-sulfonamide.
| Compound Name | 2-chloro-4-methyl-N-(5,5,5-trifluoropentyl)-1,3-thiazole-5-sulfonamide |
|---|---|
| PubChem CID | 115486666 |
| Molecular Formula | C9H12ClF3N2O2S2 |
| Molecular Weight | 336.79 g/mol |
| Exact Mass | 336.00 |
| IUPAC Name | 2-chloro-4-methyl-N-(5,5,5-trifluoropentyl)-1,3-thiazole-5-sulfonamide |
| SMILES | Cc1nc(Cl)sc1S(=O)(=O)NCCCCC(F)(F)F |
| InChI | InChI=1S/C9H12ClF3N2O2S2/c1-6-7(18-8(10)15-6)19(16,17)14-5-3-2-4-9(11,12)13/h14H,2-5H2,1H3 |
| InChIKey | GMMJQYFUAUPWAB-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.79 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|