C9H14F3N3O2S — CID 115486686
5-methyl-N-(5,5,5-trifluoropentyl)-1H-pyrazole-4-sulfonamide (PubChem CID 115486686) has the molecular formula C9H14F3N3O2S and a molecular weight of 285.29 g/mol. Its IUPAC name is 5-methyl-N-(5,5,5-trifluoropentyl)-1H-pyrazole-4-sulfonamide.
| Compound Name | 5-methyl-N-(5,5,5-trifluoropentyl)-1H-pyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 115486686 |
| Molecular Formula | C9H14F3N3O2S |
| Molecular Weight | 285.29 g/mol |
| Exact Mass | 285.08 |
| IUPAC Name | 5-methyl-N-(5,5,5-trifluoropentyl)-1H-pyrazole-4-sulfonamide |
| SMILES | Cc1[nH]ncc1S(=O)(=O)NCCCCC(F)(F)F |
| InChI | InChI=1S/C9H14F3N3O2S/c1-7-8(6-13-15-7)18(16,17)14-5-3-2-4-9(10,11)12/h6,14H,2-5H2,1H3,(H,13,15) |
| InChIKey | LFAXANDZVXUXNB-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.29 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|