C12H25NO3 — CID 115486754
1-(2,2-diethoxyethoxymethyl)cyclopentan-1-amine (PubChem CID 115486754) has the molecular formula C12H25NO3 and a molecular weight of 231.34 g/mol. Its IUPAC name is 1-(2,2-diethoxyethoxymethyl)cyclopentan-1-amine.
| Compound Name | 1-(2,2-diethoxyethoxymethyl)cyclopentan-1-amine |
|---|---|
| PubChem CID | 115486754 |
| Molecular Formula | C12H25NO3 |
| Molecular Weight | 231.34 g/mol |
| Exact Mass | 231.18 |
| IUPAC Name | 1-(2,2-diethoxyethoxymethyl)cyclopentan-1-amine |
| SMILES | CCOC(COCC1(N)CCCC1)OCC |
| InChI | InChI=1S/C12H25NO3/c1-3-15-11(16-4-2)9-14-10-12(13)7-5-6-8-12/h11H,3-10,13H2,1-2H3 |
| InChIKey | UQHPTJAIDNQIOT-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.34 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|