C14H17N3O2 — CID 115487364
1-[[(6-cyano-3-pyridinyl)amino]methyl]cyclohexane-1-carboxylic acid (PubChem CID 115487364) has the molecular formula C14H17N3O2 and a molecular weight of 259.31 g/mol. Its IUPAC name is 1-[[(6-cyano-3-pyridinyl)amino]methyl]cyclohexane-1-carboxylic acid.
| Compound Name | 1-[[(6-cyano-3-pyridinyl)amino]methyl]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 115487364 |
| Molecular Formula | C14H17N3O2 |
| Molecular Weight | 259.31 g/mol |
| Exact Mass | 259.13 |
| IUPAC Name | 1-[[(6-cyano-3-pyridinyl)amino]methyl]cyclohexane-1-carboxylic acid |
| SMILES | N#Cc1ccc(NCC2(C(=O)O)CCCCC2)cn1 |
| InChI | InChI=1S/C14H17N3O2/c15-8-11-4-5-12(9-16-11)17-10-14(13(18)19)6-2-1-3-7-14/h4-5,9,17H,1-3,6-7,10H2,(H,18,19) |
| InChIKey | VVYTWHZVBJHPPW-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 86.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.31 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |