C14H11N5OS — CID 115488946
5-[(1-phenyl-1,2,4-triazol-3-yl)oxy]pyridine-2-carbothioamide (PubChem CID 115488946) has the molecular formula C14H11N5OS and a molecular weight of 297.34 g/mol. Its IUPAC name is 5-[(1-phenyl-1,2,4-triazol-3-yl)oxy]pyridine-2-carbothioamide.
| Compound Name | 5-[(1-phenyl-1,2,4-triazol-3-yl)oxy]pyridine-2-carbothioamide |
|---|---|
| PubChem CID | 115488946 |
| Molecular Formula | C14H11N5OS |
| Molecular Weight | 297.34 g/mol |
| Exact Mass | 297.07 |
| IUPAC Name | 5-[(1-phenyl-1,2,4-triazol-3-yl)oxy]pyridine-2-carbothioamide |
| SMILES | NC(=S)c1ccc(Oc2ncn(-c3ccccc3)n2)cn1 |
| InChI | InChI=1S/C14H11N5OS/c15-13(21)12-7-6-11(8-16-12)20-14-17-9-19(18-14)10-4-2-1-3-5-10/h1-9H,(H2,15,21) |
| InChIKey | IZIOBFJNIWRCRP-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 78.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.34 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|