C13H15BrF3NO2 — CID 115491577
2-bromo-5-methoxy-N-(5,5,5-trifluoropentyl)benzamide (PubChem CID 115491577) has the molecular formula C13H15BrF3NO2 and a molecular weight of 354.17 g/mol. Its IUPAC name is 2-bromo-5-methoxy-N-(5,5,5-trifluoropentyl)benzamide.
| Compound Name | 2-bromo-5-methoxy-N-(5,5,5-trifluoropentyl)benzamide |
|---|---|
| PubChem CID | 115491577 |
| Molecular Formula | C13H15BrF3NO2 |
| Molecular Weight | 354.17 g/mol |
| Exact Mass | 353.02 |
| IUPAC Name | 2-bromo-5-methoxy-N-(5,5,5-trifluoropentyl)benzamide |
| SMILES | COc1ccc(Br)c(C(=O)NCCCCC(F)(F)F)c1 |
| InChI | InChI=1S/C13H15BrF3NO2/c1-20-9-4-5-11(14)10(8-9)12(19)18-7-3-2-6-13(15,16)17/h4-5,8H,2-3,6-7H2,1H3,(H,18,19) |
| InChIKey | NMKYHTFSSAPIIU-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.17 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|