C9H11F3N2OS — CID 115491580
N-(5,5,5-trifluoropentyl)-1,3-thiazole-4-carboxamide (PubChem CID 115491580) has the molecular formula C9H11F3N2OS and a molecular weight of 252.26 g/mol. Its IUPAC name is N-(5,5,5-trifluoropentyl)-1,3-thiazole-4-carboxamide.
| Compound Name | N-(5,5,5-trifluoropentyl)-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 115491580 |
| Molecular Formula | C9H11F3N2OS |
| Molecular Weight | 252.26 g/mol |
| Exact Mass | 252.05 |
| IUPAC Name | N-(5,5,5-trifluoropentyl)-1,3-thiazole-4-carboxamide |
| SMILES | O=C(NCCCCC(F)(F)F)c1cscn1 |
| InChI | InChI=1S/C9H11F3N2OS/c10-9(11,12)3-1-2-4-13-8(15)7-5-16-6-14-7/h5-6H,1-4H2,(H,13,15) |
| InChIKey | YVTDJIRAVCQLIW-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.26 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|